Country:
China (Mainland)
Business Type:Trading Company
Tel: 15053231572
Mobile: 15053231572
Tel: 15053231572
Fax:
URL: http://www.eastchem-cn.com
Province/state: Shangdong
City: Qingdao
Street: No.1581-12,Jinshui Road, Licang, Qingdao,China
Contact SuppliersCAS NO.85-44-9
CAS NO.85-44-9
FOB price
| Name: | Phthalic anhydride |
| Alias: | 2,5-Isobenzofurandione; 2-benzofuran-1,3-dione; 2,2'-(oxydicarbonyl)dibenzoic acid; o-Phthalic anhydride |
| CAS RN: | 85-44-9 |
| EINECS号: | 201-607-5 |
| Molecular formula: | C8H4O3 |
| Molecular weight: | 148.12 |
| InChI: | InChI=1/C16H10O7/c17-13(18)9-5-1-3-7-11(9)15(21)23-16(22)12-8-4-2-6-10(12)14(19)20/h1-8H,(H,17,18)(H,19,20) |
| Molecular structure: |
![]() |
| Density: | 1.484g/cm3 |
| Melting point: | 129-132℃ |
| Boiling point: | 589.218°C at 760 mmHg |
The primary use of phthalic anhydride is a precursor to phthalate esters, used as plasticizers in vinyl chloride. Phthalate esters are derived from phthalic anhydride by the alcoholysis reaction